C35H21F8N3OS — CID 142621845
7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-4-(1,2,2,3,3,4,4,4-octafluorobutylsulfanyloxy)quinoline (PubChem CID 142621845) has the molecular formula C35H21F8N3OS and a molecular weight of 683.62 g/mol. Its IUPAC name is 7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-4-(1,2,2,3,3,4,4,4-octafluorobutylsulfanyloxy)quinoline.
| Compound Name | 7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-4-(1,2,2,3,3,4,4,4-octafluorobutylsulfanyloxy)quinoline |
|---|---|
| PubChem CID | 142621845 |
| Molecular Formula | C35H21F8N3OS |
| Molecular Weight | 683.62 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | 7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-4-(1,2,2,3,3,4,4,4-octafluorobutylsulfanyloxy)quinoline |
| SMILES | FC(SOc1ccnc2cc(-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)ccc12)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H21F8N3OS/c36-32(33(37,38)34(39,40)35(41,42)43)48-47-30-17-18-44-29-19-25(15-16-26(29)30)21-11-13-24(14-12-21)31-45-27(22-7-3-1-4-8-22)20-28(46-31)23-9-5-2-6-10-23/h1-20,32H |
| InChIKey | UPBRYTUOCVGDKY-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.62 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|