C36H24N4O — CID 142621865
2-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinolin-4-ol (PubChem CID 142621865) has the molecular formula C36H24N4O and a molecular weight of 528.62 g/mol. Its IUPAC name is 2-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinolin-4-ol.
| Compound Name | 2-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinolin-4-ol |
|---|---|
| PubChem CID | 142621865 |
| Molecular Formula | C36H24N4O |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]quinolin-4-ol |
| SMILES | Oc1cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)nc2ccccc12 |
| InChI | InChI=1S/C36H24N4O/c41-33-23-32(37-31-20-8-7-19-30(31)33)27-16-10-18-29(22-27)36-39-34(25-13-5-2-6-14-25)38-35(40-36)28-17-9-15-26(21-28)24-11-3-1-4-12-24/h1-23H,(H,37,41) |
| InChIKey | RYJPDTBQPCRJLL-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |