C31H16F9NO2S — CID 142622020
8-(4-dibenzofuran-4-ylphenyl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline (PubChem CID 142622020) has the molecular formula C31H16F9NO2S and a molecular weight of 637.52 g/mol. Its IUPAC name is 8-(4-dibenzofuran-4-ylphenyl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline.
| Compound Name | 8-(4-dibenzofuran-4-ylphenyl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline |
|---|---|
| PubChem CID | 142622020 |
| Molecular Formula | C31H16F9NO2S |
| Molecular Weight | 637.52 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | 8-(4-dibenzofuran-4-ylphenyl)-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyloxy)quinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)SOc1ccnc2c(-c3ccc(-c4cccc5c4oc4ccccc45)cc3)cccc12 |
| InChI | InChI=1S/C31H16F9NO2S/c32-28(33,30(36,37)38)29(34,35)31(39,40)44-43-25-15-16-41-26-19(6-3-9-23(25)26)17-11-13-18(14-12-17)20-7-4-8-22-21-5-1-2-10-24(21)42-27(20)22/h1-16H |
| InChIKey | AWSIQRZZTQCELD-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.52 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|