C36H31BN4O2 — CID 142622096
3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 142622096) has the molecular formula C36H31BN4O2 and a molecular weight of 562.48 g/mol. Its IUPAC name is 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 142622096 |
| Molecular Formula | C36H31BN4O2 |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | CC1(C)OB(c2c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cnc3ccccc23)OC1(C)C |
| InChI | InChI=1S/C36H31BN4O2/c1-35(2)36(3,4)43-37(42-35)31-28-17-11-12-18-30(28)38-23-29(31)24-19-21-27(22-20-24)34-40-32(25-13-7-5-8-14-25)39-33(41-34)26-15-9-6-10-16-26/h5-23H,1-4H3 |
| InChIKey | QPACQALVRGWGMN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|