C40H36N2 — CID 142622148
2-[(E)-2-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]prop-1-enyl]-4-[4-(cyclohexa-1,5-dien-1-ylmethyl)phenyl]aniline (PubChem CID 142622148) has the molecular formula C40H36N2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]prop-1-enyl]-4-[4-(cyclohexa-1,5-dien-1-ylmethyl)phenyl]aniline.
| Compound Name | 2-[(E)-2-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]prop-1-enyl]-4-[4-(cyclohexa-1,5-dien-1-ylmethyl)phenyl]aniline |
|---|---|
| PubChem CID | 142622148 |
| Molecular Formula | C40H36N2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 2-[(E)-2-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]prop-1-enyl]-4-[4-(cyclohexa-1,5-dien-1-ylmethyl)phenyl]aniline |
| SMILES | C/C(=C\c1cc(-c2ccc(CC3=CCCC=C3)cc2)ccc1N)c1ccc(N2c3ccccc3C3C=CC=CC32)cc1 |
| InChI | InChI=1S/C40H36N2/c1-28(31-19-22-35(23-20-31)42-39-13-7-5-11-36(39)37-12-6-8-14-40(37)42)25-34-27-33(21-24-38(34)41)32-17-15-30(16-18-32)26-29-9-3-2-4-10-29/h3,5-25,27,36,39H,2,4,26,41H2,1H3/b28-25+ |
| InChIKey | FFQLENXYAREFON-AZPGRJICSA-N |
| XLogP | 10.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|