C24H36N2O2 — CID 142622417
4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid (PubChem CID 142622417) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 142622417 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid |
| SMILES | CCCCC1=C(CN2CCN(c3ccc(C(=O)O)cc3)CC2)CC(C)(C)CC1 |
| InChI | InChI=1S/C24H36N2O2/c1-4-5-6-19-11-12-24(2,3)17-21(19)18-25-13-15-26(16-14-25)22-9-7-20(8-10-22)23(27)28/h7-10H,4-6,11-18H2,1-3H3,(H,27,28) |
| InChIKey | ARXQQNXDPPAHCW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|