About 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid
4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid (PubChem CID 142622417) has the molecular formula C24H36N2O2
and a molecular weight of 384.56 g/mol. Its IUPAC name is 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid |
| PubChem CID | 142622417 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid |
| SMILES | CCCCC1=C(CN2CCN(c3ccc(C(=O)O)cc3)CC2)CC(C)(C)CC1 |
| InChI | InChI=1S/C24H36N2O2/c1-4-5-6-19-11-12-24(2,3)17-21(19)18-25-13-15-26(16-14-25)22-9-7-20(8-10-22)23(27)28/h7-10H,4-6,11-18H2,1-3H3,(H,27,28) |
| InChIKey | ARXQQNXDPPAHCW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid?
The IUPAC name of 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid (CID 142622417) is 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid.
What is the SMILES notation for 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid?
The canonical SMILES for 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid is CCCCC1=C(CN2CCN(c3ccc(C(=O)O)cc3)CC2)CC(C)(C)CC1.
What is the InChIKey of 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid?
The InChIKey is ARXQQNXDPPAHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36N2O2/c1-4-5-6-19-11-12-24(2,3)17-21(19)18-25-13-15-26(16-14-25)22-9-7-20(8-10-22)23(27)28/h7-10H,4-6,11-18H2,1-3H3,(H,27,28).
What are the key properties of 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid?
4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid has a molecular weight of 384.56 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2-butyl-5,5-dimethylcyclohexen-1-yl)methyl]piperazin-1-yl]benzoic acid is sourced from PubChem (CID 142622417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).