About S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate
S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate (PubChem CID 142623416) has the molecular formula C12H13N3O2S
and a molecular weight of 263.32 g/mol. Its IUPAC name is S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate.
Molecular Properties
| Compound Name | S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate |
| PubChem CID | 142623416 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate |
| SMILES | CC(SC(=O)NC=O)c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C12H13N3O2S/c1-8(18-12(17)13-7-16)11-9-5-3-4-6-10(9)15(2)14-11/h3-8H,1-2H3,(H,13,16,17) |
| InChIKey | NDCJNQHXNBXZTQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate?
The IUPAC name of S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate (CID 142623416) is S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate.
What is the SMILES notation for S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate?
The canonical SMILES for S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate is CC(SC(=O)NC=O)c1nn(C)c2ccccc12.
What is the InChIKey of S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate?
The InChIKey is NDCJNQHXNBXZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S/c1-8(18-12(17)13-7-16)11-9-5-3-4-6-10(9)15(2)14-11/h3-8H,1-2H3,(H,13,16,17).
What are the key properties of S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate?
S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate has a molecular weight of 263.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-(1-methylindazol-3-yl)ethyl] N-formylcarbamothioate is sourced from PubChem (CID 142623416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).