C11H8Cl3NO2S — CID 142623515
3-(2,4,5-trichlorophenyl)sulfanylpiperidine-2,6-dione (PubChem CID 142623515) has the molecular formula C11H8Cl3NO2S and a molecular weight of 324.62 g/mol. Its IUPAC name is 3-(2,4,5-trichlorophenyl)sulfanylpiperidine-2,6-dione.
| Compound Name | 3-(2,4,5-trichlorophenyl)sulfanylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 142623515 |
| Molecular Formula | C11H8Cl3NO2S |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 3-(2,4,5-trichlorophenyl)sulfanylpiperidine-2,6-dione |
| SMILES | O=C1CCC(Sc2cc(Cl)c(Cl)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C11H8Cl3NO2S/c12-5-3-7(14)9(4-6(5)13)18-8-1-2-10(16)15-11(8)17/h3-4,8H,1-2H2,(H,15,16,17) |
| InChIKey | PYOSQHCRXMIYNU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|