C19H34O2 — CID 142623863
2-[[(1S,2R,5S,7R,8S)-2,6,6,8,9-pentamethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]propan-2-ol (PubChem CID 142623863) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-[[(1S,2R,5S,7R,8S)-2,6,6,8,9-pentamethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]propan-2-ol.
| Compound Name | 2-[[(1S,2R,5S,7R,8S)-2,6,6,8,9-pentamethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 142623863 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 2-[[(1S,2R,5S,7R,8S)-2,6,6,8,9-pentamethyl-8-tricyclo[5.3.1.01,5]undecanyl]oxy]propan-2-ol |
| SMILES | CC1C[C@@]23C[C@H](C(C)(C)[C@@H]2CC[C@H]3C)[C@@]1(C)OC(C)(C)O |
| InChI | InChI=1S/C19H34O2/c1-12-8-9-14-16(3,4)15-11-19(12,14)10-13(2)18(15,7)21-17(5,6)20/h12-15,20H,8-11H2,1-7H3/t12-,13?,14+,15-,18+,19+/m1/s1 |
| InChIKey | ILQFKEIIQFSHKU-ZDSYPLGUSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|