About ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine
ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine (PubChem CID 142623943) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine.
Molecular Properties
| Compound Name | ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine |
| PubChem CID | 142623943 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine |
| SMILES | C=CC1=C(/N=C/C)CCN1.CC |
| InChI | InChI=1S/C8H12N2.C2H6/c1-3-7-8(9-4-2)5-6-10-7;1-2/h3-4,10H,1,5-6H2,2H3;1-2H3/b9-4+; |
| InChIKey | VRADFNIKUCAYLX-JOKMOOFLSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine?
The IUPAC name of ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine (CID 142623943) is ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine.
What is the SMILES notation for ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine?
The canonical SMILES for ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine is C=CC1=C(/N=C/C)CCN1.CC.
What is the InChIKey of ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine?
The InChIKey is VRADFNIKUCAYLX-JOKMOOFLSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c1-3-7-8(9-4-2)5-6-10-7;1-2/h3-4,10H,1,5-6H2,2H3;1-2H3/b9-4+;.
What are the key properties of ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine?
ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine has a molecular weight of 166.27 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(5-ethenyl-2,3-dihydro-1H-pyrrol-4-yl)ethanimine is sourced from PubChem (CID 142623943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).