C22H20F3N7O4S2 — CID 142624126
(Z)-2-[amino(methyl)amino]-2-[1-(benzenesulfonyl)-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]pyrrolo[2,3-b]pyridin-6-yl]ethenamine (PubChem CID 142624126) has the molecular formula C22H20F3N7O4S2 and a molecular weight of 567.58 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-2-[1-(benzenesulfonyl)-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]pyrrolo[2,3-b]pyridin-6-yl]ethenamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-2-[1-(benzenesulfonyl)-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]pyrrolo[2,3-b]pyridin-6-yl]ethenamine |
|---|---|
| PubChem CID | 142624126 |
| Molecular Formula | C22H20F3N7O4S2 |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-2-[1-(benzenesulfonyl)-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]pyrrolo[2,3-b]pyridin-6-yl]ethenamine |
| SMILES | CN(N)/C(=C\N)c1ccc2c(-c3nc(S(C)(=O)=O)ncc3C(F)(F)F)cn(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H20F3N7O4S2/c1-31(27)18(10-26)17-9-8-14-15(19-16(22(23,24)25)11-28-21(30-19)37(2,33)34)12-32(20(14)29-17)38(35,36)13-6-4-3-5-7-13/h3-12H,26-27H2,1-2H3/b18-10- |
| InChIKey | SJPPFINXXXWEJV-ZDLGFXPLSA-N |
| XLogP | 2.22 |
| TPSA | 167.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|