C30H35F3N6O4 — CID 142624252
tert-butyl (3S)-3-[[4-[6-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1-methylcyclopropanecarbonyl]-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 142624252) has the molecular formula C30H35F3N6O4 and a molecular weight of 600.64 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[6-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1-methylcyclopropanecarbonyl]-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[6-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1-methylcyclopropanecarbonyl]-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142624252 |
| Molecular Formula | C30H35F3N6O4 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[6-[2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-1-methylcyclopropanecarbonyl]-1H-indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | C/C(=N/O)C1CC1(C)C(=O)c1ccc2c(-c3nc(N[C@H]4CCCN(C(=O)OC(C)(C)C)C4)ncc3C(F)(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C30H35F3N6O4/c1-16(38-42)21-12-29(21,5)25(40)17-8-9-19-20(13-34-23(19)11-17)24-22(30(31,32)33)14-35-26(37-24)36-18-7-6-10-39(15-18)27(41)43-28(2,3)4/h8-9,11,13-14,18,21,34,42H,6-7,10,12,15H2,1-5H3,(H,35,36,37)/b38-16-/t18-,21?,29?/m0/s1 |
| InChIKey | KJJJKBNFCAUTOZ-TVUNKTEOSA-N |
| XLogP | 6.51 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|