About 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine
4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 142624269) has the molecular formula C15H9F3N6S
and a molecular weight of 362.34 g/mol. Its IUPAC name is 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 142624269 |
| Molecular Formula | C15H9F3N6S |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(C(F)(F)F)c(-c2n[nH]c3cc(-c4nccs4)ccc23)n1 |
| InChI | InChI=1S/C15H9F3N6S/c16-15(17,18)9-6-21-14(19)22-12(9)11-8-2-1-7(5-10(8)23-24-11)13-20-3-4-25-13/h1-6H,(H,23,24)(H2,19,21,22) |
| InChIKey | NNXHIXZLOODYGC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine (CID 142624269) is 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine is Nc1ncc(C(F)(F)F)c(-c2n[nH]c3cc(-c4nccs4)ccc23)n1.
What is the InChIKey of 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is NNXHIXZLOODYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N6S/c16-15(17,18)9-6-21-14(19)22-12(9)11-8-2-1-7(5-10(8)23-24-11)13-20-3-4-25-13/h1-6H,(H,23,24)(H2,19,21,22).
What are the key properties of 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine?
4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 362.34 g/mol, XLogP of 3.74, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1,3-thiazol-2-yl)-1H-indazol-3-yl]-5-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 142624269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).