C8H9F7 — CID 142625065
1,1,2,2,3,3,3-heptafluoropropylcyclopentane (PubChem CID 142625065) has the molecular formula C8H9F7 and a molecular weight of 238.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropylcyclopentane.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropylcyclopentane |
|---|---|
| PubChem CID | 142625065 |
| Molecular Formula | C8H9F7 |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropylcyclopentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1CCCC1 |
| InChI | InChI=1S/C8H9F7/c9-6(10,5-3-1-2-4-5)7(11,12)8(13,14)15/h5H,1-4H2 |
| InChIKey | RJGVHARJJXRGQO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|