About 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one
1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one (PubChem CID 142625149) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one.
Molecular Properties
| Compound Name | 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one |
| PubChem CID | 142625149 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one |
| SMILES | NCC(F)(F)C(=O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C11H20F2N2O/c12-11(13,7-14)10(16)9(15)6-8-4-2-1-3-5-8/h8-9H,1-7,14-15H2 |
| InChIKey | BUKKIPYDJLSDLR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one?
The IUPAC name of 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one (CID 142625149) is 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one.
What is the SMILES notation for 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one?
The canonical SMILES for 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one is NCC(F)(F)C(=O)C(N)CC1CCCCC1.
What is the InChIKey of 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one?
The InChIKey is BUKKIPYDJLSDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O/c12-11(13,7-14)10(16)9(15)6-8-4-2-1-3-5-8/h8-9H,1-7,14-15H2.
What are the key properties of 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one?
1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one has a molecular weight of 234.29 g/mol, XLogP of 1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diamino-5-cyclohexyl-2,2-difluoropentan-3-one is sourced from PubChem (CID 142625149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).