About chlorosyl 2-phenylacetate
chlorosyl 2-phenylacetate (PubChem CID 142625224) has the molecular formula C8H7ClO3
and a molecular weight of 186.59 g/mol. Its IUPAC name is chlorosyl 2-phenylacetate.
Molecular Properties
| Compound Name | chlorosyl 2-phenylacetate |
| PubChem CID | 142625224 |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | chlorosyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)O[Cl+][O-] |
| InChI | InChI=1S/C8H7ClO3/c10-8(12-9-11)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | TYSKAFRBPORIRG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.59 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze chlorosyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosyl 2-phenylacetate?
The IUPAC name of chlorosyl 2-phenylacetate (CID 142625224) is chlorosyl 2-phenylacetate.
What is the SMILES notation for chlorosyl 2-phenylacetate?
The canonical SMILES for chlorosyl 2-phenylacetate is O=C(Cc1ccccc1)O[Cl+][O-].
What is the InChIKey of chlorosyl 2-phenylacetate?
The InChIKey is TYSKAFRBPORIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO3/c10-8(12-9-11)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of chlorosyl 2-phenylacetate?
chlorosyl 2-phenylacetate has a molecular weight of 186.59 g/mol, XLogP of 0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosyl 2-phenylacetate is sourced from PubChem (CID 142625224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).