About methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate
methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate (PubChem CID 142625776) has the molecular formula C16H21ClO3
and a molecular weight of 296.79 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate |
| PubChem CID | 142625776 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate |
| SMILES | COC(=O)C(C)c1ccc(C[C@@H]2CCC[C@H]2O)cc1Cl |
| InChI | InChI=1S/C16H21ClO3/c1-10(16(19)20-2)13-7-6-11(9-14(13)17)8-12-4-3-5-15(12)18/h6-7,9-10,12,15,18H,3-5,8H2,1-2H3/t10?,12-,15+/m0/s1 |
| InChIKey | UVRPMVWLMZGFLN-PMPKIWSKSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate?
The IUPAC name of methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate (CID 142625776) is methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate.
What is the SMILES notation for methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate?
The canonical SMILES for methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate is COC(=O)C(C)c1ccc(C[C@@H]2CCC[C@H]2O)cc1Cl.
What is the InChIKey of methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate?
The InChIKey is UVRPMVWLMZGFLN-PMPKIWSKSA-N. The full InChI is InChI=1S/C16H21ClO3/c1-10(16(19)20-2)13-7-6-11(9-14(13)17)8-12-4-3-5-15(12)18/h6-7,9-10,12,15,18H,3-5,8H2,1-2H3/t10?,12-,15+/m0/s1.
What are the key properties of methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate?
methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate has a molecular weight of 296.79 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-chloro-4-[[(1S,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoate is sourced from PubChem (CID 142625776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).