C9H11Cl2N3S — CID 142626465
1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-amine;dihydrochloride (PubChem CID 142626465) has the molecular formula C9H11Cl2N3S and a molecular weight of 264.18 g/mol. Its IUPAC name is 1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-amine;dihydrochloride.
| Compound Name | 1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-amine;dihydrochloride |
|---|---|
| PubChem CID | 142626465 |
| Molecular Formula | C9H11Cl2N3S |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-6-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc2c(c1)SC1=NCCN12 |
| InChI | InChI=1S/C9H9N3S.2ClH/c10-6-1-2-7-8(5-6)13-9-11-3-4-12(7)9;;/h1-2,5H,3-4,10H2;2*1H |
| InChIKey | NQEYRFAFEDXDEI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|