About 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine
5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine (PubChem CID 142626520) has the molecular formula C11H13Cl2NO
and a molecular weight of 246.14 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine |
| PubChem CID | 142626520 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine |
| SMILES | CCC1NCC(c2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-2-11-14-6-10(15-11)7-3-4-8(12)9(13)5-7/h3-5,10-11,14H,2,6H2,1H3 |
| InChIKey | QBPILTMRYWWYGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine?
The IUPAC name of 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine (CID 142626520) is 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine?
The canonical SMILES for 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine is CCC1NCC(c2ccc(Cl)c(Cl)c2)O1.
What is the InChIKey of 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine?
The InChIKey is QBPILTMRYWWYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO/c1-2-11-14-6-10(15-11)7-3-4-8(12)9(13)5-7/h3-5,10-11,14H,2,6H2,1H3.
What are the key properties of 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine?
5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine has a molecular weight of 246.14 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-2-ethyl-1,3-oxazolidine is sourced from PubChem (CID 142626520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).