About 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide
2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide (PubChem CID 142626699) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide |
| PubChem CID | 142626699 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)C1(N2CCNCC2)NC=CS1 |
| InChI | InChI=1S/C8H14N4OS/c9-7(13)8(11-3-6-14-8)12-4-1-10-2-5-12/h3,6,10-11H,1-2,4-5H2,(H2,9,13) |
| InChIKey | SGTPPQDQXMDLRT-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide?
The IUPAC name of 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide (CID 142626699) is 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide?
The canonical SMILES for 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide is NC(=O)C1(N2CCNCC2)NC=CS1.
What is the InChIKey of 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide?
The InChIKey is SGTPPQDQXMDLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c9-7(13)8(11-3-6-14-8)12-4-1-10-2-5-12/h3,6,10-11H,1-2,4-5H2,(H2,9,13).
What are the key properties of 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide?
2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide has a molecular weight of 214.29 g/mol, XLogP of -1.16, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-3H-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 142626699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).