C24H38O4 — CID 14262688
[(E)-5-[(1R,4aR,7S,8aR)-7-acetyloxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl] acetate (PubChem CID 14262688) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(E)-5-[(1R,4aR,7S,8aR)-7-acetyloxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[(1R,4aR,7S,8aR)-7-acetyloxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 14262688 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(E)-5-[(1R,4aR,7S,8aR)-7-acetyloxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@@H]1C(C)=CC[C@@H]2C(C)(C)C[C@H](OC(C)=O)C[C@@]12C |
| InChI | InChI=1S/C24H38O4/c1-16(12-13-27-18(3)25)8-10-21-17(2)9-11-22-23(5,6)14-20(28-19(4)26)15-24(21,22)7/h9,12,20-22H,8,10-11,13-15H2,1-7H3/b16-12+/t20-,21+,22+,24-/m0/s1 |
| InChIKey | YHWGGOVTUYUUOG-XZXWLPLMSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|