About N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 142627821) has the molecular formula C15H19Cl2N3O4S
and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| PubChem CID | 142627821 |
| Molecular Formula | C15H19Cl2N3O4S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CON=C(CNC(=O)C1CCCN1S(C)(=O)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O4S/c1-24-19-13(11-6-5-10(16)8-12(11)17)9-18-15(21)14-4-3-7-20(14)25(2,22)23/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,18,21) |
| InChIKey | RJBUCNSRHOAIKQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide?
The IUPAC name of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide (CID 142627821) is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide?
The canonical SMILES for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide is CON=C(CNC(=O)C1CCCN1S(C)(=O)=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide?
The InChIKey is RJBUCNSRHOAIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N3O4S/c1-24-19-13(11-6-5-10(16)8-12(11)17)9-18-15(21)14-4-3-7-20(14)25(2,22)23/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,18,21).
What are the key properties of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide?
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide has a molecular weight of 408.31 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-1-methylsulfonylpyrrolidine-2-carboxamide is sourced from PubChem (CID 142627821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).