About N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide (PubChem CID 142627827) has the molecular formula C12H15Cl2N3O4S
and a molecular weight of 368.24 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide.
Molecular Properties
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide |
| PubChem CID | 142627827 |
| Molecular Formula | C12H15Cl2N3O4S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide |
| SMILES | CON=C(CNC(=O)CNS(C)(=O)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N3O4S/c1-21-17-11(9-4-3-8(13)5-10(9)14)6-15-12(18)7-16-22(2,19)20/h3-5,16H,6-7H2,1-2H3,(H,15,18) |
| InChIKey | QWEWNZPAVYVNSE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide?
The IUPAC name of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide (CID 142627827) is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide.
What is the SMILES notation for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide?
The canonical SMILES for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide is CON=C(CNC(=O)CNS(C)(=O)=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide?
The InChIKey is QWEWNZPAVYVNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2N3O4S/c1-21-17-11(9-4-3-8(13)5-10(9)14)6-15-12(18)7-16-22(2,19)20/h3-5,16H,6-7H2,1-2H3,(H,15,18).
What are the key properties of N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide?
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide has a molecular weight of 368.24 g/mol, XLogP of 1.01, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)acetamide is sourced from PubChem (CID 142627827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).