C20H24O5 — CID 14262819
7,8-dimethyl-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-3,9-dione (PubChem CID 14262819) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 7,8-dimethyl-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-3,9-dione.
| Compound Name | 7,8-dimethyl-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-3,9-dione |
|---|---|
| PubChem CID | 14262819 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 7,8-dimethyl-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-3,9-dione |
| SMILES | CC1C(=O)CC23COC(=O)C2=CCCC3C1(C)CCC1=CCOC1=O |
| InChI | InChI=1S/C20H24O5/c1-12-15(21)10-20-11-25-18(23)14(20)4-3-5-16(20)19(12,2)8-6-13-7-9-24-17(13)22/h4,7,12,16H,3,5-6,8-11H2,1-2H3 |
| InChIKey | JUGXEOXLYIYYCQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |