About 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate
2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate (PubChem CID 142628379) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate |
| PubChem CID | 142628379 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate |
| SMILES | CC(=O)NC1NC(C)=C(CCOC(C)=O)C(=O)N1C |
| InChI | InChI=1S/C12H19N3O4/c1-7-10(5-6-19-9(3)17)11(18)15(4)12(13-7)14-8(2)16/h12-13H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | FNRGUMDBRNADFP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate?
The IUPAC name of 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate (CID 142628379) is 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate.
What is the SMILES notation for 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate?
The canonical SMILES for 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate is CC(=O)NC1NC(C)=C(CCOC(C)=O)C(=O)N1C.
What is the InChIKey of 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate?
The InChIKey is FNRGUMDBRNADFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4/c1-7-10(5-6-19-9(3)17)11(18)15(4)12(13-7)14-8(2)16/h12-13H,5-6H2,1-4H3,(H,14,16).
What are the key properties of 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate?
2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate has a molecular weight of 269.30 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acetamido-3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-5-yl)ethyl acetate is sourced from PubChem (CID 142628379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).