C43H40N4O4 — CID 142630014
ethyl 2-[5-methyl-5-naphthalen-1-yl-2,4-dioxo-3-[3-(3-tritylimidazol-4-yl)propyl]imidazolidin-1-yl]acetate (PubChem CID 142630014) has the molecular formula C43H40N4O4 and a molecular weight of 676.82 g/mol. Its IUPAC name is ethyl 2-[5-methyl-5-naphthalen-1-yl-2,4-dioxo-3-[3-(3-tritylimidazol-4-yl)propyl]imidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-methyl-5-naphthalen-1-yl-2,4-dioxo-3-[3-(3-tritylimidazol-4-yl)propyl]imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 142630014 |
| Molecular Formula | C43H40N4O4 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | ethyl 2-[5-methyl-5-naphthalen-1-yl-2,4-dioxo-3-[3-(3-tritylimidazol-4-yl)propyl]imidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)N(CCCc2cncn2C(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C1(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C43H40N4O4/c1-3-51-39(48)30-46-41(50)45(40(49)42(46,2)38-27-15-18-32-17-13-14-26-37(32)38)28-16-25-36-29-44-31-47(36)43(33-19-7-4-8-20-33,34-21-9-5-10-22-34)35-23-11-6-12-24-35/h4-15,17-24,26-27,29,31H,3,16,25,28,30H2,1-2H3 |
| InChIKey | RITLWCZFSKWAOP-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|