About 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine
6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 142630305) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 142630305 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CCOC1C=CCCN1C |
| InChI | InChI=1S/C8H15NO/c1-3-10-8-6-4-5-7-9(8)2/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | ZMOJDSXIJUIMAE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine (CID 142630305) is 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine is CCOC1C=CCCN1C.
What is the InChIKey of 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is ZMOJDSXIJUIMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-3-10-8-6-4-5-7-9(8)2/h4,6,8H,3,5,7H2,1-2H3.
What are the key properties of 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine?
6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 141.21 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 142630305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).