C10H7BrN2O5S — CID 142631299
2-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenesulfonic acid (PubChem CID 142631299) has the molecular formula C10H7BrN2O5S and a molecular weight of 347.15 g/mol. Its IUPAC name is 2-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenesulfonic acid.
| Compound Name | 2-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenesulfonic acid |
|---|---|
| PubChem CID | 142631299 |
| Molecular Formula | C10H7BrN2O5S |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethenesulfonic acid |
| SMILES | O=c1[nH]c2cc(Br)cc(C=CS(=O)(=O)O)c2[nH]c1=O |
| InChI | InChI=1S/C10H7BrN2O5S/c11-6-3-5(1-2-19(16,17)18)8-7(4-6)12-9(14)10(15)13-8/h1-4H,(H,12,14)(H,13,15)(H,16,17,18) |
| InChIKey | MMKALRWUMWRIGY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|