About 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane
11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane (PubChem CID 14263132) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane.
Analyze 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane?
The IUPAC name of 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane (CID 14263132) is 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane.
What is the SMILES notation for 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane?
The canonical SMILES for 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane is COC12CC3(C)CCCC1CC(C)(C)C2CC3.
What is the InChIKey of 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane?
The InChIKey is SODCVOFIADSJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O/c1-14(2)10-12-6-5-8-15(3)9-7-13(14)16(12,11-15)17-4/h12-13H,5-11H2,1-4H3.
What are the key properties of 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane?
11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane has a molecular weight of 236.40 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methoxy-3,3,7-trimethyltricyclo[5.3.2.04,11]dodecane is sourced from PubChem (CID 14263132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).