About tricyclo[5.2.1.01,6]decane
tricyclo[5.2.1.01,6]decane (PubChem CID 142631987) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is tricyclo[5.2.1.01,6]decane.
Molecular Properties
| Compound Name | tricyclo[5.2.1.01,6]decane |
| PubChem CID | 142631987 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | tricyclo[5.2.1.01,6]decane |
| SMILES | C1CCC23CCC(C2)C3C1 |
| InChI | InChI=1S/C10H16/c1-2-5-10-6-4-8(7-10)9(10)3-1/h8-9H,1-7H2 |
| InChIKey | VDSREHWGDRKAER-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[5.2.1.01,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.01,6]decane?
The IUPAC name of tricyclo[5.2.1.01,6]decane (CID 142631987) is tricyclo[5.2.1.01,6]decane.
What is the SMILES notation for tricyclo[5.2.1.01,6]decane?
The canonical SMILES for tricyclo[5.2.1.01,6]decane is C1CCC23CCC(C2)C3C1.
What is the InChIKey of tricyclo[5.2.1.01,6]decane?
The InChIKey is VDSREHWGDRKAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-2-5-10-6-4-8(7-10)9(10)3-1/h8-9H,1-7H2.
What are the key properties of tricyclo[5.2.1.01,6]decane?
tricyclo[5.2.1.01,6]decane has a molecular weight of 136.24 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.01,6]decane is sourced from PubChem (CID 142631987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).