C15H19NO8 — CID 142632198
6-(1-hydroxypropan-2-ylcarbamoyl)bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid (PubChem CID 142632198) has the molecular formula C15H19NO8 and a molecular weight of 341.32 g/mol. Its IUPAC name is 6-(1-hydroxypropan-2-ylcarbamoyl)bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid.
| Compound Name | 6-(1-hydroxypropan-2-ylcarbamoyl)bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 142632198 |
| Molecular Formula | C15H19NO8 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 6-(1-hydroxypropan-2-ylcarbamoyl)bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid |
| SMILES | CC(CO)NC(=O)C1C2C=CC(C(C(=O)O)C2C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C15H19NO8/c1-5(4-17)16-12(18)8-6-2-3-7(9(8)13(19)20)11(15(23)24)10(6)14(21)22/h2-3,5-11,17H,4H2,1H3,(H,16,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XJIXGAIPSNUHPI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|