About 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea
1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea (PubChem CID 142632462) has the molecular formula C19H28Cl2N4O2
and a molecular weight of 415.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea |
| PubChem CID | 142632462 |
| Molecular Formula | C19H28Cl2N4O2 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea |
| SMILES | CC(C)CC(NC(=O)NC1CCCCC1)C(=O)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H28Cl2N4O2/c1-12(2)10-17(23-19(27)22-14-6-4-3-5-7-14)18(26)25-24-16-9-8-13(20)11-15(16)21/h8-9,11-12,14,17,24H,3-7,10H2,1-2H3,(H,25,26)(H2,22,23,27) |
| InChIKey | LOGXENGBMZWLOR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea?
The IUPAC name of 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea (CID 142632462) is 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea.
What is the SMILES notation for 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea?
The canonical SMILES for 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea is CC(C)CC(NC(=O)NC1CCCCC1)C(=O)NNc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea?
The InChIKey is LOGXENGBMZWLOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28Cl2N4O2/c1-12(2)10-17(23-19(27)22-14-6-4-3-5-7-14)18(26)25-24-16-9-8-13(20)11-15(16)21/h8-9,11-12,14,17,24H,3-7,10H2,1-2H3,(H,25,26)(H2,22,23,27).
What are the key properties of 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea?
1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea has a molecular weight of 415.37 g/mol, XLogP of 4.48, 7 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]urea is sourced from PubChem (CID 142632462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).