C20H22Cl3N3O3 — CID 142632496
tert-butyl N-[1-oxo-3-phenyl-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]propan-2-yl]carbamate (PubChem CID 142632496) has the molecular formula C20H22Cl3N3O3 and a molecular weight of 458.77 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-3-phenyl-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-3-phenyl-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 142632496 |
| Molecular Formula | C20H22Cl3N3O3 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | tert-butyl N-[1-oxo-3-phenyl-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl3N3O3/c1-20(2,3)29-19(28)24-16(9-12-7-5-4-6-8-12)18(27)26-25-17-14(22)10-13(21)11-15(17)23/h4-8,10-11,16,25H,9H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | BKSBJIUBDXVXGU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|