About 1,5,8,8a-tetrahydroindolizine
1,5,8,8a-tetrahydroindolizine (PubChem CID 142632613) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 1,5,8,8a-tetrahydroindolizine.
Molecular Properties
| Compound Name | 1,5,8,8a-tetrahydroindolizine |
| PubChem CID | 142632613 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 1,5,8,8a-tetrahydroindolizine |
| SMILES | C1=CCN2C=CCC2C1 |
| InChI | InChI=1S/C8H11N/c1-2-6-9-7-3-5-8(9)4-1/h1-3,7-8H,4-6H2 |
| InChIKey | HEMJPBWKUZITNZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,5,8,8a-tetrahydroindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,8,8a-tetrahydroindolizine?
The IUPAC name of 1,5,8,8a-tetrahydroindolizine (CID 142632613) is 1,5,8,8a-tetrahydroindolizine.
What is the SMILES notation for 1,5,8,8a-tetrahydroindolizine?
The canonical SMILES for 1,5,8,8a-tetrahydroindolizine is C1=CCN2C=CCC2C1.
What is the InChIKey of 1,5,8,8a-tetrahydroindolizine?
The InChIKey is HEMJPBWKUZITNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-2-6-9-7-3-5-8(9)4-1/h1-3,7-8H,4-6H2.
What are the key properties of 1,5,8,8a-tetrahydroindolizine?
1,5,8,8a-tetrahydroindolizine has a molecular weight of 121.18 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,8,8a-tetrahydroindolizine is sourced from PubChem (CID 142632613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).