C15H17NO2 — CID 142633098
5-benzyl-1-ethyl-6-hydroxyiminocyclohexa-2,4-dien-1-ol (PubChem CID 142633098) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-benzyl-1-ethyl-6-hydroxyiminocyclohexa-2,4-dien-1-ol.
| Compound Name | 5-benzyl-1-ethyl-6-hydroxyiminocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 142633098 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 5-benzyl-1-ethyl-6-hydroxyiminocyclohexa-2,4-dien-1-ol |
| SMILES | CCC1(O)C=CC=C(Cc2ccccc2)C1=NO |
| InChI | InChI=1S/C15H17NO2/c1-2-15(17)10-6-9-13(14(15)16-18)11-12-7-4-3-5-8-12/h3-10,17-18H,2,11H2,1H3 |
| InChIKey | FRCGBTYLDXDHOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|