C14H13ClN2O3 — CID 142633142
(E)-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]but-2-enoic acid (PubChem CID 142633142) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is (E)-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]but-2-enoic acid.
| Compound Name | (E)-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 142633142 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (E)-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]but-2-enoic acid |
| SMILES | C/C=C(\C(=O)O)N1N=C(c2ccc(Cl)cc2)CCC1=O |
| InChI | InChI=1S/C14H13ClN2O3/c1-2-12(14(19)20)17-13(18)8-7-11(16-17)9-3-5-10(15)6-4-9/h2-6H,7-8H2,1H3,(H,19,20)/b12-2+ |
| InChIKey | SBAIXGRBTATZIP-SWGQDTFXSA-N |
| XLogP | 2.65 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|