C22H28N2O2 — CID 142633495
2-benzyl-2-methoxy-1-(4-piperazin-1-ylphenyl)butan-1-one (PubChem CID 142633495) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-benzyl-2-methoxy-1-(4-piperazin-1-ylphenyl)butan-1-one.
| Compound Name | 2-benzyl-2-methoxy-1-(4-piperazin-1-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 142633495 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-benzyl-2-methoxy-1-(4-piperazin-1-ylphenyl)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(OC)C(=O)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-3-22(26-2,17-18-7-5-4-6-8-18)21(25)19-9-11-20(12-10-19)24-15-13-23-14-16-24/h4-12,23H,3,13-17H2,1-2H3 |
| InChIKey | CLQPERVUWLRISC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |