C30H44N6O4 — CID 142633838
ethyl (2S)-2-acetamido-4-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]butanoate (PubChem CID 142633838) has the molecular formula C30H44N6O4 and a molecular weight of 552.72 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-4-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]butanoate.
| Compound Name | ethyl (2S)-2-acetamido-4-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 142633838 |
| Molecular Formula | C30H44N6O4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | ethyl (2S)-2-acetamido-4-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3C(=O)[C@H]3CCCN3CC[C@H](NC(C)=O)C(=O)OCC)n(CC)c2c1 |
| InChI | InChI=1S/C30H44N6O4/c1-4-35-24(18-21-10-11-22(28(31)32)19-27(21)35)13-12-23-8-6-16-36(23)29(38)26-9-7-15-34(26)17-14-25(33-20(3)37)30(39)40-5-2/h10-11,18-19,23,25-26H,4-9,12-17H2,1-3H3,(H3,31,32)(H,33,37)/t23-,25-,26+/m0/s1 |
| InChIKey | WUAPHYHIPLUAFJ-AYRHNUGRSA-N |
| XLogP | 2.79 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|