About 4-methoxy-2H-isoindole
4-methoxy-2H-isoindole (PubChem CID 142633953) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-methoxy-2H-isoindole.
Molecular Properties
| Compound Name | 4-methoxy-2H-isoindole |
| PubChem CID | 142633953 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-methoxy-2H-isoindole |
| SMILES | COc1cccc2c[nH]cc12 |
| InChI | InChI=1S/C9H9NO/c1-11-9-4-2-3-7-5-10-6-8(7)9/h2-6,10H,1H3 |
| InChIKey | IOBICLOAZHGZJG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methoxy-2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2H-isoindole?
The IUPAC name of 4-methoxy-2H-isoindole (CID 142633953) is 4-methoxy-2H-isoindole.
What is the SMILES notation for 4-methoxy-2H-isoindole?
The canonical SMILES for 4-methoxy-2H-isoindole is COc1cccc2c[nH]cc12.
What is the InChIKey of 4-methoxy-2H-isoindole?
The InChIKey is IOBICLOAZHGZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-11-9-4-2-3-7-5-10-6-8(7)9/h2-6,10H,1H3.
What are the key properties of 4-methoxy-2H-isoindole?
4-methoxy-2H-isoindole has a molecular weight of 147.18 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2H-isoindole is sourced from PubChem (CID 142633953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).