C20H18N2O5 — CID 142634047
2-(2-cyanophenoxy)-2-(4-cyanophenoxy)-3-hydroxyhexanoic acid (PubChem CID 142634047) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-2-(4-cyanophenoxy)-3-hydroxyhexanoic acid.
| Compound Name | 2-(2-cyanophenoxy)-2-(4-cyanophenoxy)-3-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 142634047 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(2-cyanophenoxy)-2-(4-cyanophenoxy)-3-hydroxyhexanoic acid |
| SMILES | CCCC(O)C(Oc1ccc(C#N)cc1)(Oc1ccccc1C#N)C(=O)O |
| InChI | InChI=1S/C20H18N2O5/c1-2-5-18(23)20(19(24)25,26-16-10-8-14(12-21)9-11-16)27-17-7-4-3-6-15(17)13-22/h3-4,6-11,18,23H,2,5H2,1H3,(H,24,25) |
| InChIKey | RNDTXPFHWNEUIG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|