About N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide
N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide (PubChem CID 142634383) has the molecular formula C25H30N2O
and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide |
| PubChem CID | 142634383 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide |
| SMILES | CC[C@H](C)[C@H](N)CN(Cc1cccc2ccccc12)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H30N2O/c1-4-19(3)24(26)17-27(25(28)21-14-12-18(2)13-15-21)16-22-10-7-9-20-8-5-6-11-23(20)22/h5-15,19,24H,4,16-17,26H2,1-3H3/t19-,24+/m0/s1 |
| InChIKey | BOGMGUVHWAXSPR-YADARESESA-N |
| XLogP | 5.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide?
The IUPAC name of N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide (CID 142634383) is N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide.
What is the SMILES notation for N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide?
The canonical SMILES for N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide is CC[C@H](C)[C@H](N)CN(Cc1cccc2ccccc12)C(=O)c1ccc(C)cc1.
What is the InChIKey of N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide?
The InChIKey is BOGMGUVHWAXSPR-YADARESESA-N. The full InChI is InChI=1S/C25H30N2O/c1-4-19(3)24(26)17-27(25(28)21-14-12-18(2)13-15-21)16-22-10-7-9-20-8-5-6-11-23(20)22/h5-15,19,24H,4,16-17,26H2,1-3H3/t19-,24+/m0/s1.
What are the key properties of N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide?
N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide has a molecular weight of 374.53 g/mol, XLogP of 5.16, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-2-amino-3-methylpentyl]-4-methyl-N-(naphthalen-1-ylmethyl)benzamide is sourced from PubChem (CID 142634383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).