C29H33N5O3 — CID 142634406
N-[(2S)-4-methyl-1-(naphthalen-1-ylmethylamino)pentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide (PubChem CID 142634406) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-(naphthalen-1-ylmethylamino)pentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide.
| Compound Name | N-[(2S)-4-methyl-1-(naphthalen-1-ylmethylamino)pentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 142634406 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[(2S)-4-methyl-1-(naphthalen-1-ylmethylamino)pentan-2-yl]-2-[3-[(4-nitrophenyl)methyl]imidazol-4-yl]acetamide |
| SMILES | CC(C)C[C@@H](CNCc1cccc2ccccc12)NC(=O)Cc1cncn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H33N5O3/c1-21(2)14-25(17-30-16-24-8-5-7-23-6-3-4-9-28(23)24)32-29(35)15-27-18-31-20-33(27)19-22-10-12-26(13-11-22)34(36)37/h3-13,18,20-21,25,30H,14-17,19H2,1-2H3,(H,32,35)/t25-/m0/s1 |
| InChIKey | HJCKMPKBXGSIQQ-VWLOTQADSA-N |
| XLogP | 4.86 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|