C14H13F4N3O2S — CID 142634574
2-[[5-(fluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 142634574) has the molecular formula C14H13F4N3O2S and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[[5-(fluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[5-(fluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 142634574 |
| Molecular Formula | C14H13F4N3O2S |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[[5-(fluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-propan-2-yl-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(C)N(C(=O)COc1nnc(CF)s1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H13F4N3O2S/c1-7(2)21(9-4-3-8(16)12(17)13(9)18)11(22)6-23-14-20-19-10(5-15)24-14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | DPUZZARXDSAABX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|