C29H40O13 — CID 142634842
3-[1,2,2-tris(2-carboxyethyl)-3,3,4,4-tetrakis(oxiran-2-ylmethyl)-5-oxocyclopentyl]propanoic acid (PubChem CID 142634842) has the molecular formula C29H40O13 and a molecular weight of 596.63 g/mol. Its IUPAC name is 3-[1,2,2-tris(2-carboxyethyl)-3,3,4,4-tetrakis(oxiran-2-ylmethyl)-5-oxocyclopentyl]propanoic acid.
| Compound Name | 3-[1,2,2-tris(2-carboxyethyl)-3,3,4,4-tetrakis(oxiran-2-ylmethyl)-5-oxocyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 142634842 |
| Molecular Formula | C29H40O13 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 3-[1,2,2-tris(2-carboxyethyl)-3,3,4,4-tetrakis(oxiran-2-ylmethyl)-5-oxocyclopentyl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)O)C(=O)C(CC2CO2)(CC2CO2)C(CC2CO2)(CC2CO2)C1(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C29H40O13/c30-21(31)1-5-26(6-2-22(32)33)25(38)27(9-17-13-39-17,10-18-14-40-18)29(11-19-15-41-19,12-20-16-42-20)28(26,7-3-23(34)35)8-4-24(36)37/h17-20H,1-16H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | IOLSLOCFIZPGNW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 216.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|