About 2,4-diethoxy-6-iodo-1,3,5-triazine
2,4-diethoxy-6-iodo-1,3,5-triazine (PubChem CID 142634981) has the molecular formula C7H10IN3O2
and a molecular weight of 295.08 g/mol. Its IUPAC name is 2,4-diethoxy-6-iodo-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-diethoxy-6-iodo-1,3,5-triazine |
| PubChem CID | 142634981 |
| Molecular Formula | C7H10IN3O2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 2,4-diethoxy-6-iodo-1,3,5-triazine |
| SMILES | CCOc1nc(I)nc(OCC)n1 |
| InChI | InChI=1S/C7H10IN3O2/c1-3-12-6-9-5(8)10-7(11-6)13-4-2/h3-4H2,1-2H3 |
| InChIKey | GKTUJXQAIYZYEX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethoxy-6-iodo-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethoxy-6-iodo-1,3,5-triazine?
The IUPAC name of 2,4-diethoxy-6-iodo-1,3,5-triazine (CID 142634981) is 2,4-diethoxy-6-iodo-1,3,5-triazine.
What is the SMILES notation for 2,4-diethoxy-6-iodo-1,3,5-triazine?
The canonical SMILES for 2,4-diethoxy-6-iodo-1,3,5-triazine is CCOc1nc(I)nc(OCC)n1.
What is the InChIKey of 2,4-diethoxy-6-iodo-1,3,5-triazine?
The InChIKey is GKTUJXQAIYZYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10IN3O2/c1-3-12-6-9-5(8)10-7(11-6)13-4-2/h3-4H2,1-2H3.
What are the key properties of 2,4-diethoxy-6-iodo-1,3,5-triazine?
2,4-diethoxy-6-iodo-1,3,5-triazine has a molecular weight of 295.08 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethoxy-6-iodo-1,3,5-triazine is sourced from PubChem (CID 142634981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).