C7H10IN3O2 — CID 142634981
2,4-diethoxy-6-iodo-1,3,5-triazine (PubChem CID 142634981) has the molecular formula C7H10IN3O2 and a molecular weight of 295.08 g/mol. Its IUPAC name is 2,4-diethoxy-6-iodo-1,3,5-triazine.
| Compound Name | 2,4-diethoxy-6-iodo-1,3,5-triazine |
|---|---|
| PubChem CID | 142634981 |
| Molecular Formula | C7H10IN3O2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 2,4-diethoxy-6-iodo-1,3,5-triazine |
| SMILES | CCOc1nc(I)nc(OCC)n1 |
| InChI | InChI=1S/C7H10IN3O2/c1-3-12-6-9-5(8)10-7(11-6)13-4-2/h3-4H2,1-2H3 |
| InChIKey | GKTUJXQAIYZYEX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|