C25H38F6O2Si — CID 142635078
7-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol (PubChem CID 142635078) has the molecular formula C25H38F6O2Si and a molecular weight of 512.65 g/mol. Its IUPAC name is 7-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol.
| Compound Name | 7-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
|---|---|
| PubChem CID | 142635078 |
| Molecular Formula | C25H38F6O2Si |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 7-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
| SMILES | CC(C=CC#CC(O)(C(F)(F)F)C(F)(F)F)C1CCC2C(O[Si](C)(C)C(C)(C)C)CCCC12C |
| InChI | InChI=1S/C25H38F6O2Si/c1-17(11-8-9-16-23(32,24(26,27)28)25(29,30)31)18-13-14-19-20(12-10-15-22(18,19)5)33-34(6,7)21(2,3)4/h8,11,17-20,32H,10,12-15H2,1-7H3 |
| InChIKey | HLQWUESUJNWOCH-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|