About 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione
2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione (PubChem CID 142635544) has the molecular formula C14H13FN2O4
and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione |
| PubChem CID | 142635544 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione |
| SMILES | O=C1C(F)=C(N2CCNCC2)C(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C14H13FN2O4/c15-11-12(17-5-3-16-4-6-17)14(21)10-8(19)2-1-7(18)9(10)13(11)20/h1-2,16,18-19H,3-6H2 |
| InChIKey | OQJJTSAZXHEHSQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione?
The IUPAC name of 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione (CID 142635544) is 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione.
What is the SMILES notation for 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione?
The canonical SMILES for 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione is O=C1C(F)=C(N2CCNCC2)C(=O)c2c(O)ccc(O)c21.
What is the InChIKey of 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione?
The InChIKey is OQJJTSAZXHEHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O4/c15-11-12(17-5-3-16-4-6-17)14(21)10-8(19)2-1-7(18)9(10)13(11)20/h1-2,16,18-19H,3-6H2.
What are the key properties of 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione?
2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione has a molecular weight of 292.27 g/mol, XLogP of 0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione is sourced from PubChem (CID 142635544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).