C14H13FN2O4 — CID 142635544
2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione (PubChem CID 142635544) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142635544 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-fluoro-5,8-dihydroxy-3-piperazin-1-ylnaphthalene-1,4-dione |
| SMILES | O=C1C(F)=C(N2CCNCC2)C(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C14H13FN2O4/c15-11-12(17-5-3-16-4-6-17)14(21)10-8(19)2-1-7(18)9(10)13(11)20/h1-2,16,18-19H,3-6H2 |
| InChIKey | OQJJTSAZXHEHSQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|