About methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate
methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate (PubChem CID 142635685) has the molecular formula C19H20N2O5
and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate |
| PubChem CID | 142635685 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C(=O)c2[nH]c(=O)[nH]c(=O)c2C(C)C)c(C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-10(2)15-16(20-19(25)21-18(15)24)17(23)13-7-5-12(9-11(13)3)6-8-14(22)26-4/h5-10H,1-4H3,(H2,20,21,24,25)/b8-6+ |
| InChIKey | QAMFTLJJTJVJGU-SOFGYWHQSA-N |
| XLogP | 1.91 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate?
The IUPAC name of methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate (CID 142635685) is methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate is COC(=O)/C=C/c1ccc(C(=O)c2[nH]c(=O)[nH]c(=O)c2C(C)C)c(C)c1.
What is the InChIKey of methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate?
The InChIKey is QAMFTLJJTJVJGU-SOFGYWHQSA-N. The full InChI is InChI=1S/C19H20N2O5/c1-10(2)15-16(20-19(25)21-18(15)24)17(23)13-7-5-12(9-11(13)3)6-8-14(22)26-4/h5-10H,1-4H3,(H2,20,21,24,25)/b8-6+.
What are the key properties of methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate?
methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate has a molecular weight of 356.38 g/mol, XLogP of 1.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[4-(2,4-dioxo-5-propan-2-yl-1H-pyrimidine-6-carbonyl)-3-methylphenyl]prop-2-enoate is sourced from PubChem (CID 142635685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).