About methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate
methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate (PubChem CID 142635880) has the molecular formula C21H31N5O2
and a molecular weight of 385.51 g/mol. Its IUPAC name is methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate |
| PubChem CID | 142635880 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate |
| SMILES | [H]/N=C(\C)N1CCC(N(CC(C)C(=O)OC)c2ccc3nc(C)n(C)c3c2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-14(21(27)28-5)13-26(17-8-10-25(11-9-17)15(2)22)18-6-7-19-20(12-18)24(4)16(3)23-19/h6-7,12,14,17,22H,8-11,13H2,1-5H3/b22-15+ |
| InChIKey | BHEDEKKWKPNEMW-PXLXIMEGSA-N |
| XLogP | 2.96 |
| TPSA | 74.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate?
The IUPAC name of methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate (CID 142635880) is methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate.
What is the SMILES notation for methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate?
The canonical SMILES for methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate is [H]/N=C(\C)N1CCC(N(CC(C)C(=O)OC)c2ccc3nc(C)n(C)c3c2)CC1.
What is the InChIKey of methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate?
The InChIKey is BHEDEKKWKPNEMW-PXLXIMEGSA-N. The full InChI is InChI=1S/C21H31N5O2/c1-14(21(27)28-5)13-26(17-8-10-25(11-9-17)15(2)22)18-6-7-19-20(12-18)24(4)16(3)23-19/h6-7,12,14,17,22H,8-11,13H2,1-5H3/b22-15+.
What are the key properties of methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate?
methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate has a molecular weight of 385.51 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,3-dimethylbenzimidazol-5-yl)-(1-ethanimidoylpiperidin-4-yl)amino]-2-methylpropanoate is sourced from PubChem (CID 142635880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).