C15H17N3O — CID 142636548
N-(3,4,6,7,7a,7b-hexahydro-2H-indolo[2,3-a]quinolizin-1-ylidene)hydroxylamine (PubChem CID 142636548) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(3,4,6,7,7a,7b-hexahydro-2H-indolo[2,3-a]quinolizin-1-ylidene)hydroxylamine.
| Compound Name | N-(3,4,6,7,7a,7b-hexahydro-2H-indolo[2,3-a]quinolizin-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 142636548 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(3,4,6,7,7a,7b-hexahydro-2H-indolo[2,3-a]quinolizin-1-ylidene)hydroxylamine |
| SMILES | ON=C1CCCN2CCC3C(=C12)N=C1C=CC=CC13 |
| InChI | InChI=1S/C15H17N3O/c19-17-13-6-3-8-18-9-7-11-10-4-1-2-5-12(10)16-14(11)15(13)18/h1-2,4-5,10-11,19H,3,6-9H2 |
| InChIKey | PSMSFIJDXQDYTQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|